C14H21NO2S — CID 106658623
N-(2-ethylsulfanylphenyl)-2,2-dimethyl-1,3-dioxan-5-amine (PubChem CID 106658623) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is N-(2-ethylsulfanylphenyl)-2,2-dimethyl-1,3-dioxan-5-amine.
| Compound Name | N-(2-ethylsulfanylphenyl)-2,2-dimethyl-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 106658623 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N-(2-ethylsulfanylphenyl)-2,2-dimethyl-1,3-dioxan-5-amine |
| SMILES | CCSc1ccccc1NC1COC(C)(C)OC1 |
| InChI | InChI=1S/C14H21NO2S/c1-4-18-13-8-6-5-7-12(13)15-11-9-16-14(2,3)17-10-11/h5-8,11,15H,4,9-10H2,1-3H3 |
| InChIKey | NJHRKXPGPKUERX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |