C13H27NO2 — CID 106658781
N-(3-ethylpentan-2-yl)-2,2-dimethyl-1,3-dioxan-5-amine (PubChem CID 106658781) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is N-(3-ethylpentan-2-yl)-2,2-dimethyl-1,3-dioxan-5-amine.
| Compound Name | N-(3-ethylpentan-2-yl)-2,2-dimethyl-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 106658781 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | N-(3-ethylpentan-2-yl)-2,2-dimethyl-1,3-dioxan-5-amine |
| SMILES | CCC(CC)C(C)NC1COC(C)(C)OC1 |
| InChI | InChI=1S/C13H27NO2/c1-6-11(7-2)10(3)14-12-8-15-13(4,5)16-9-12/h10-12,14H,6-9H2,1-5H3 |
| InChIKey | RVOFUOVDVHCSTB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |