C10H20N2O3 — CID 104585278
3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]butanamide (PubChem CID 104585278) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]butanamide.
| Compound Name | 3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]butanamide |
|---|---|
| PubChem CID | 104585278 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]butanamide |
| SMILES | CC(CC(N)=O)NC1COC(C)(C)OC1 |
| InChI | InChI=1S/C10H20N2O3/c1-7(4-9(11)13)12-8-5-14-10(2,3)15-6-8/h7-8,12H,4-6H2,1-3H3,(H2,11,13) |
| InChIKey | IPZHALUGNDTGPP-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |