C10H14F3N3 — CID 106659304
4-butyl-N-methyl-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 106659304) has the molecular formula C10H14F3N3 and a molecular weight of 233.24 g/mol. Its IUPAC name is 4-butyl-N-methyl-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-butyl-N-methyl-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 106659304 |
| Molecular Formula | C10H14F3N3 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 4-butyl-N-methyl-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CCCCc1cc(C(F)(F)F)nc(NC)n1 |
| InChI | InChI=1S/C10H14F3N3/c1-3-4-5-7-6-8(10(11,12)13)16-9(14-2)15-7/h6H,3-5H2,1-2H3,(H,14,15,16) |
| InChIKey | WTTDBHBHOBXITG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |