About 5-methoxy-2-methyl-N-(1,2-oxazol-3-ylmethyl)pyridin-4-amine
5-methoxy-2-methyl-N-(1,2-oxazol-3-ylmethyl)pyridin-4-amine (PubChem CID 106660618) has the molecular formula C11H13N3O2
and a molecular weight of 219.24 g/mol. Its IUPAC name is 5-methoxy-2-methyl-N-(1,2-oxazol-3-ylmethyl)pyridin-4-amine.
Molecular Properties
| Compound Name | 5-methoxy-2-methyl-N-(1,2-oxazol-3-ylmethyl)pyridin-4-amine |
| PubChem CID | 106660618 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 5-methoxy-2-methyl-N-(1,2-oxazol-3-ylmethyl)pyridin-4-amine |
| SMILES | COc1cnc(C)cc1NCc1ccon1 |
| InChI | InChI=1S/C11H13N3O2/c1-8-5-10(11(15-2)7-12-8)13-6-9-3-4-16-14-9/h3-5,7H,6H2,1-2H3,(H,12,13) |
| InChIKey | KWNCKQPBJHADMZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methoxy-2-methyl-N-(1,2-oxazol-3-ylmethyl)pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2-methyl-N-(1,2-oxazol-3-ylmethyl)pyridin-4-amine?
The IUPAC name of 5-methoxy-2-methyl-N-(1,2-oxazol-3-ylmethyl)pyridin-4-amine (CID 106660618) is 5-methoxy-2-methyl-N-(1,2-oxazol-3-ylmethyl)pyridin-4-amine.
What is the SMILES notation for 5-methoxy-2-methyl-N-(1,2-oxazol-3-ylmethyl)pyridin-4-amine?
The canonical SMILES for 5-methoxy-2-methyl-N-(1,2-oxazol-3-ylmethyl)pyridin-4-amine is COc1cnc(C)cc1NCc1ccon1.
What is the InChIKey of 5-methoxy-2-methyl-N-(1,2-oxazol-3-ylmethyl)pyridin-4-amine?
The InChIKey is KWNCKQPBJHADMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2/c1-8-5-10(11(15-2)7-12-8)13-6-9-3-4-16-14-9/h3-5,7H,6H2,1-2H3,(H,12,13).
What are the key properties of 5-methoxy-2-methyl-N-(1,2-oxazol-3-ylmethyl)pyridin-4-amine?
5-methoxy-2-methyl-N-(1,2-oxazol-3-ylmethyl)pyridin-4-amine has a molecular weight of 219.24 g/mol, XLogP of 2.00, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-methyl-N-(1,2-oxazol-3-ylmethyl)pyridin-4-amine is sourced from PubChem (CID 106660618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).