C15H22IN — CID 106662008
3-iodo-4-methyl-N-(2,4,4-trimethylcyclopentyl)aniline (PubChem CID 106662008) has the molecular formula C15H22IN and a molecular weight of 343.25 g/mol. Its IUPAC name is 3-iodo-4-methyl-N-(2,4,4-trimethylcyclopentyl)aniline.
| Compound Name | 3-iodo-4-methyl-N-(2,4,4-trimethylcyclopentyl)aniline |
|---|---|
| PubChem CID | 106662008 |
| Molecular Formula | C15H22IN |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 3-iodo-4-methyl-N-(2,4,4-trimethylcyclopentyl)aniline |
| SMILES | Cc1ccc(NC2CC(C)(C)CC2C)cc1I |
| InChI | InChI=1S/C15H22IN/c1-10-5-6-12(7-13(10)16)17-14-9-15(3,4)8-11(14)2/h5-7,11,14,17H,8-9H2,1-4H3 |
| InChIKey | CFVJZWHUFNGQTJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|