C15H23N3O — CID 106662193
[4-[(2,4,4-trimethylcyclopentyl)amino]phenyl]urea (PubChem CID 106662193) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is [4-[(2,4,4-trimethylcyclopentyl)amino]phenyl]urea.
| Compound Name | [4-[(2,4,4-trimethylcyclopentyl)amino]phenyl]urea |
|---|---|
| PubChem CID | 106662193 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | [4-[(2,4,4-trimethylcyclopentyl)amino]phenyl]urea |
| SMILES | CC1CC(C)(C)CC1Nc1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C15H23N3O/c1-10-8-15(2,3)9-13(10)17-11-4-6-12(7-5-11)18-14(16)19/h4-7,10,13,17H,8-9H2,1-3H3,(H3,16,18,19) |
| InChIKey | RXRIAWBSZUXHSP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |