C18H28N2O — CID 81302611
N,N-dimethyl-4-[(2,4,4-trimethylcyclohexyl)amino]benzamide (PubChem CID 81302611) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is N,N-dimethyl-4-[(2,4,4-trimethylcyclohexyl)amino]benzamide.
| Compound Name | N,N-dimethyl-4-[(2,4,4-trimethylcyclohexyl)amino]benzamide |
|---|---|
| PubChem CID | 81302611 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | N,N-dimethyl-4-[(2,4,4-trimethylcyclohexyl)amino]benzamide |
| SMILES | CC1CC(C)(C)CCC1Nc1ccc(C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C18H28N2O/c1-13-12-18(2,3)11-10-16(13)19-15-8-6-14(7-9-15)17(21)20(4)5/h6-9,13,16,19H,10-12H2,1-5H3 |
| InChIKey | OSIDASNCSVEHTJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |