C14H25N5 — CID 106663173
[1-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2,4,4-trimethylcyclopentyl]methanamine (PubChem CID 106663173) has the molecular formula C14H25N5 and a molecular weight of 263.39 g/mol. Its IUPAC name is [1-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2,4,4-trimethylcyclopentyl]methanamine.
| Compound Name | [1-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2,4,4-trimethylcyclopentyl]methanamine |
|---|---|
| PubChem CID | 106663173 |
| Molecular Formula | C14H25N5 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | [1-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2,4,4-trimethylcyclopentyl]methanamine |
| SMILES | CC1CC(C)(C)CC1(CN)N1CCn2cnnc2C1 |
| InChI | InChI=1S/C14H25N5/c1-11-6-13(2,3)8-14(11,9-15)19-5-4-18-10-16-17-12(18)7-19/h10-11H,4-9,15H2,1-3H3 |
| InChIKey | KAISEIFZJDVCBK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |