2-[1-(diethylamino)-2,4,4-trimethylcyclopentyl]acetic acid

C14H27NO2 — CID 106664177

IUPAC2-[1-(diethylamino)-2,4,4-trimethylcyclopentyl]acetic acid
SMILESCCN(CC)C1(CC(=O)O)CC(C)(C)CC1C
InChIInChI=1S/C14H27NO2/c1-6-15(7-2)14(9-12(16)17)10-13(4,5)8-11(14)3/h11H,6-10H2,1-5H3,(H,16,17)
InChIKeyGPTUFKHZWDMMMV-UHFFFAOYSA-N
MW241.37 g/mol
LogP3.00
Rot. Bonds5

About 2-[1-(diethylamino)-2,4,4-trimethylcyclopentyl]acetic acid

2-[1-(diethylamino)-2,4,4-trimethylcyclopentyl]acetic acid (PubChem CID 106664177) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is 2-[1-(diethylamino)-2,4,4-trimethylcyclopentyl]acetic acid.

Molecular Properties

Compound Name2-[1-(diethylamino)-2,4,4-trimethylcyclopentyl]acetic acid
PubChem CID106664177
Molecular FormulaC14H27NO2
Molecular Weight241.37 g/mol
Exact Mass241.20
IUPAC Name2-[1-(diethylamino)-2,4,4-trimethylcyclopentyl]acetic acid
SMILESCCN(CC)C1(CC(=O)O)CC(C)(C)CC1C
InChIInChI=1S/C14H27NO2/c1-6-15(7-2)14(9-12(16)17)10-13(4,5)8-11(14)3/h11H,6-10H2,1-5H3,(H,16,17)
InChIKeyGPTUFKHZWDMMMV-UHFFFAOYSA-N
XLogP3.00
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.37
LogP ≤ 53.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[1-(diethylamino)-2,4,4-trimethylcyclopentyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(diethylamino)-2,4,4-trimethylcyclopentyl]acetic acid?
The IUPAC name of 2-[1-(diethylamino)-2,4,4-trimethylcyclopentyl]acetic acid (CID 106664177) is 2-[1-(diethylamino)-2,4,4-trimethylcyclopentyl]acetic acid.
What is the SMILES notation for 2-[1-(diethylamino)-2,4,4-trimethylcyclopentyl]acetic acid?
The canonical SMILES for 2-[1-(diethylamino)-2,4,4-trimethylcyclopentyl]acetic acid is CCN(CC)C1(CC(=O)O)CC(C)(C)CC1C.
What is the InChIKey of 2-[1-(diethylamino)-2,4,4-trimethylcyclopentyl]acetic acid?
The InChIKey is GPTUFKHZWDMMMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO2/c1-6-15(7-2)14(9-12(16)17)10-13(4,5)8-11(14)3/h11H,6-10H2,1-5H3,(H,16,17).
What are the key properties of 2-[1-(diethylamino)-2,4,4-trimethylcyclopentyl]acetic acid?
2-[1-(diethylamino)-2,4,4-trimethylcyclopentyl]acetic acid has a molecular weight of 241.37 g/mol, XLogP of 3.00, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(diethylamino)-2,4,4-trimethylcyclopentyl]acetic acid is sourced from PubChem (CID 106664177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).