C18H27NO2 — CID 106664210
4-(N-(2,4,4-trimethylcyclopentyl)anilino)butanoic acid (PubChem CID 106664210) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 4-(N-(2,4,4-trimethylcyclopentyl)anilino)butanoic acid.
| Compound Name | 4-(N-(2,4,4-trimethylcyclopentyl)anilino)butanoic acid |
|---|---|
| PubChem CID | 106664210 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 4-(N-(2,4,4-trimethylcyclopentyl)anilino)butanoic acid |
| SMILES | CC1CC(C)(C)CC1N(CCCC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C18H27NO2/c1-14-12-18(2,3)13-16(14)19(11-7-10-17(20)21)15-8-5-4-6-9-15/h4-6,8-9,14,16H,7,10-13H2,1-3H3,(H,20,21) |
| InChIKey | MFCXBOYCWVSQFY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |