C13H15N3O3 — CID 106667079
(6-amino-1H-indol-3-yl)-(3,4-dihydroxypyrrolidin-1-yl)methanone (PubChem CID 106667079) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is (6-amino-1H-indol-3-yl)-(3,4-dihydroxypyrrolidin-1-yl)methanone.
| Compound Name | (6-amino-1H-indol-3-yl)-(3,4-dihydroxypyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 106667079 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | (6-amino-1H-indol-3-yl)-(3,4-dihydroxypyrrolidin-1-yl)methanone |
| SMILES | Nc1ccc2c(C(=O)N3CC(O)C(O)C3)c[nH]c2c1 |
| InChI | InChI=1S/C13H15N3O3/c14-7-1-2-8-9(4-15-10(8)3-7)13(19)16-5-11(17)12(18)6-16/h1-4,11-12,15,17-18H,5-6,14H2 |
| InChIKey | TXOMTHWYSPANMC-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|