C16H33NO2 — CID 106667112
N-[[1-(3-methoxy-3-methylbutoxy)-4-methylcyclohexyl]methyl]ethanamine (PubChem CID 106667112) has the molecular formula C16H33NO2 and a molecular weight of 271.44 g/mol. Its IUPAC name is N-[[1-(3-methoxy-3-methylbutoxy)-4-methylcyclohexyl]methyl]ethanamine.
| Compound Name | N-[[1-(3-methoxy-3-methylbutoxy)-4-methylcyclohexyl]methyl]ethanamine |
|---|---|
| PubChem CID | 106667112 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | N-[[1-(3-methoxy-3-methylbutoxy)-4-methylcyclohexyl]methyl]ethanamine |
| SMILES | CCNCC1(OCCC(C)(C)OC)CCC(C)CC1 |
| InChI | InChI=1S/C16H33NO2/c1-6-17-13-16(9-7-14(2)8-10-16)19-12-11-15(3,4)18-5/h14,17H,6-13H2,1-5H3 |
| InChIKey | NCALOXWAMSVVDG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |