C20H32O4S — CID 10666740
propan-2-yl 11-(benzenesulfinyl)-10-hydroxyundecanoate (PubChem CID 10666740) has the molecular formula C20H32O4S and a molecular weight of 368.54 g/mol. Its IUPAC name is propan-2-yl 11-(benzenesulfinyl)-10-hydroxyundecanoate.
| Compound Name | propan-2-yl 11-(benzenesulfinyl)-10-hydroxyundecanoate |
|---|---|
| PubChem CID | 10666740 |
| Molecular Formula | C20H32O4S |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | propan-2-yl 11-(benzenesulfinyl)-10-hydroxyundecanoate |
| SMILES | CC(C)OC(=O)CCCCCCCCC(O)CS(=O)c1ccccc1 |
| InChI | InChI=1S/C20H32O4S/c1-17(2)24-20(22)15-11-6-4-3-5-8-12-18(21)16-25(23)19-13-9-7-10-14-19/h7,9-10,13-14,17-18,21H,3-6,8,11-12,15-16H2,1-2H3 |
| InChIKey | YQWIRWUJJIJGGE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|