C8H15F3N2O2 — CID 106667814
1-(3-amino-1,1,1-trifluorobutan-2-yl)pyrrolidine-3,4-diol (PubChem CID 106667814) has the molecular formula C8H15F3N2O2 and a molecular weight of 228.21 g/mol. Its IUPAC name is 1-(3-amino-1,1,1-trifluorobutan-2-yl)pyrrolidine-3,4-diol.
| Compound Name | 1-(3-amino-1,1,1-trifluorobutan-2-yl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106667814 |
| Molecular Formula | C8H15F3N2O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 1-(3-amino-1,1,1-trifluorobutan-2-yl)pyrrolidine-3,4-diol |
| SMILES | CC(N)C(N1CC(O)C(O)C1)C(F)(F)F |
| InChI | InChI=1S/C8H15F3N2O2/c1-4(12)7(8(9,10)11)13-2-5(14)6(15)3-13/h4-7,14-15H,2-3,12H2,1H3 |
| InChIKey | JSNFXPZBCASYSL-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |