C10H14N4O2 — CID 106669769
3-(3,4-dihydroxypyrrolidin-1-yl)pyridine-2-carboximidamide (PubChem CID 106669769) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 3-(3,4-dihydroxypyrrolidin-1-yl)pyridine-2-carboximidamide.
| Compound Name | 3-(3,4-dihydroxypyrrolidin-1-yl)pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 106669769 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 3-(3,4-dihydroxypyrrolidin-1-yl)pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ncccc1N1CC(O)C(O)C1 |
| InChI | InChI=1S/C10H14N4O2/c11-10(12)9-6(2-1-3-13-9)14-4-7(15)8(16)5-14/h1-3,7-8,15-16H,4-5H2,(H3,11,12) |
| InChIKey | YPAJATYBIVQTNI-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|