C7H15N3O2 — CID 106669804
3-(3,4-dihydroxypyrrolidin-1-yl)propanimidamide (PubChem CID 106669804) has the molecular formula C7H15N3O2 and a molecular weight of 173.22 g/mol. Its IUPAC name is 3-(3,4-dihydroxypyrrolidin-1-yl)propanimidamide.
| Compound Name | 3-(3,4-dihydroxypyrrolidin-1-yl)propanimidamide |
|---|---|
| PubChem CID | 106669804 |
| Molecular Formula | C7H15N3O2 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 3-(3,4-dihydroxypyrrolidin-1-yl)propanimidamide |
| SMILES | [H]/N=C(\N)CCN1CC(O)C(O)C1 |
| InChI | InChI=1S/C7H15N3O2/c8-7(9)1-2-10-3-5(11)6(12)4-10/h5-6,11-12H,1-4H2,(H3,8,9) |
| InChIKey | MTAINAHMJJTHEL-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|