C17H28N2O5S — CID 10667012
N-hydroxy-2-[[4-(3-methylbutoxy)phenyl]sulfonyl-(2-methylpropyl)amino]acetamide (PubChem CID 10667012) has the molecular formula C17H28N2O5S and a molecular weight of 372.49 g/mol. Its IUPAC name is N-hydroxy-2-[[4-(3-methylbutoxy)phenyl]sulfonyl-(2-methylpropyl)amino]acetamide.
| Compound Name | N-hydroxy-2-[[4-(3-methylbutoxy)phenyl]sulfonyl-(2-methylpropyl)amino]acetamide |
|---|---|
| PubChem CID | 10667012 |
| Molecular Formula | C17H28N2O5S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | N-hydroxy-2-[[4-(3-methylbutoxy)phenyl]sulfonyl-(2-methylpropyl)amino]acetamide |
| SMILES | CC(C)CCOc1ccc(S(=O)(=O)N(CC(=O)NO)CC(C)C)cc1 |
| InChI | InChI=1S/C17H28N2O5S/c1-13(2)9-10-24-15-5-7-16(8-6-15)25(22,23)19(11-14(3)4)12-17(20)18-21/h5-8,13-14,21H,9-12H2,1-4H3,(H,18,20) |
| InChIKey | GATKQMPWFHNBFF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|