C10H17NO4 — CID 106670121
methyl 4-(3,4-dihydroxypyrrolidin-1-yl)-2-methylbut-2-enoate (PubChem CID 106670121) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is methyl 4-(3,4-dihydroxypyrrolidin-1-yl)-2-methylbut-2-enoate.
| Compound Name | methyl 4-(3,4-dihydroxypyrrolidin-1-yl)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 106670121 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | methyl 4-(3,4-dihydroxypyrrolidin-1-yl)-2-methylbut-2-enoate |
| SMILES | COC(=O)C(C)=CCN1CC(O)C(O)C1 |
| InChI | InChI=1S/C10H17NO4/c1-7(10(14)15-2)3-4-11-5-8(12)9(13)6-11/h3,8-9,12-13H,4-6H2,1-2H3 |
| InChIKey | PLTZJNHZUUIJKU-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|