C13H21N3O3 — CID 106670459
1-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]pyrrolidine-3,4-diol (PubChem CID 106670459) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 1-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106670459 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 1-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]pyrrolidine-3,4-diol |
| SMILES | COCCNCc1ccc(N2CC(O)C(O)C2)nc1 |
| InChI | InChI=1S/C13H21N3O3/c1-19-5-4-14-6-10-2-3-13(15-7-10)16-8-11(17)12(18)9-16/h2-3,7,11-12,14,17-18H,4-6,8-9H2,1H3 |
| InChIKey | OXWRTAPMVICNDP-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|