C11H16N2O2 — CID 177167295
1-(5-ethyl-2-pyridinyl)pyrrolidine-3,4-diol (PubChem CID 177167295) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-(5-ethyl-2-pyridinyl)pyrrolidine-3,4-diol.
| Compound Name | 1-(5-ethyl-2-pyridinyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 177167295 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 1-(5-ethyl-2-pyridinyl)pyrrolidine-3,4-diol |
| SMILES | CCc1ccc(N2CC(O)C(O)C2)nc1 |
| InChI | InChI=1S/C11H16N2O2/c1-2-8-3-4-11(12-5-8)13-6-9(14)10(15)7-13/h3-5,9-10,14-15H,2,6-7H2,1H3 |
| InChIKey | WSXOVJLPVHQQHS-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |