C22H37N3 — CID 178164965
5-ethyl-2-[4-[2-(1-propan-2-ylpiperidin-4-yl)ethyl]piperidin-1-yl]pyridine (PubChem CID 178164965) has the molecular formula C22H37N3 and a molecular weight of 343.56 g/mol. Its IUPAC name is 5-ethyl-2-[4-[2-(1-propan-2-ylpiperidin-4-yl)ethyl]piperidin-1-yl]pyridine.
| Compound Name | 5-ethyl-2-[4-[2-(1-propan-2-ylpiperidin-4-yl)ethyl]piperidin-1-yl]pyridine |
|---|---|
| PubChem CID | 178164965 |
| Molecular Formula | C22H37N3 |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.30 |
| IUPAC Name | 5-ethyl-2-[4-[2-(1-propan-2-ylpiperidin-4-yl)ethyl]piperidin-1-yl]pyridine |
| SMILES | CCc1ccc(N2CCC(CCC3CCN(C(C)C)CC3)CC2)nc1 |
| InChI | InChI=1S/C22H37N3/c1-4-19-7-8-22(23-17-19)25-15-11-21(12-16-25)6-5-20-9-13-24(14-10-20)18(2)3/h7-8,17-18,20-21H,4-6,9-16H2,1-3H3 |
| InChIKey | UKRUYESRDATUDJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |