C27H39N3O2 — CID 89109464
(2R)-2-[1-[4-[3-[1-(5-ethyl-2-pyridinyl)piperidin-4-yl]propoxy]-2-methylphenyl]ethenylamino]propan-1-ol (PubChem CID 89109464) has the molecular formula C27H39N3O2 and a molecular weight of 437.63 g/mol. Its IUPAC name is (2R)-2-[1-[4-[3-[1-(5-ethyl-2-pyridinyl)piperidin-4-yl]propoxy]-2-methylphenyl]ethenylamino]propan-1-ol.
| Compound Name | (2R)-2-[1-[4-[3-[1-(5-ethyl-2-pyridinyl)piperidin-4-yl]propoxy]-2-methylphenyl]ethenylamino]propan-1-ol |
|---|---|
| PubChem CID | 89109464 |
| Molecular Formula | C27H39N3O2 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.30 |
| IUPAC Name | (2R)-2-[1-[4-[3-[1-(5-ethyl-2-pyridinyl)piperidin-4-yl]propoxy]-2-methylphenyl]ethenylamino]propan-1-ol |
| SMILES | C=C(N[C@H](C)CO)c1ccc(OCCCC2CCN(c3ccc(CC)cn3)CC2)cc1C |
| InChI | InChI=1S/C27H39N3O2/c1-5-23-8-11-27(28-18-23)30-14-12-24(13-15-30)7-6-16-32-25-9-10-26(20(2)17-25)22(4)29-21(3)19-31/h8-11,17-18,21,24,29,31H,4-7,12-16,19H2,1-3H3/t21-/m1/s1 |
| InChIKey | VBPFKXBROYQENK-OAQYLSRUSA-N |
| XLogP | 4.97 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|