C25H34N2O2 — CID 143923505
4-[3-[1-(5-tert-butyl-2-pyridinyl)piperidin-4-yl]propoxy]-2-methylbenzaldehyde (PubChem CID 143923505) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 4-[3-[1-(5-tert-butyl-2-pyridinyl)piperidin-4-yl]propoxy]-2-methylbenzaldehyde.
| Compound Name | 4-[3-[1-(5-tert-butyl-2-pyridinyl)piperidin-4-yl]propoxy]-2-methylbenzaldehyde |
|---|---|
| PubChem CID | 143923505 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 4-[3-[1-(5-tert-butyl-2-pyridinyl)piperidin-4-yl]propoxy]-2-methylbenzaldehyde |
| SMILES | Cc1cc(OCCCC2CCN(c3ccc(C(C)(C)C)cn3)CC2)ccc1C=O |
| InChI | InChI=1S/C25H34N2O2/c1-19-16-23(9-7-21(19)18-28)29-15-5-6-20-11-13-27(14-12-20)24-10-8-22(17-26-24)25(2,3)4/h7-10,16-18,20H,5-6,11-15H2,1-4H3 |
| InChIKey | GQSIBDLUOTUKDY-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|