C8H10N6O2 — CID 106673388
1-(tetrazolo[1,5-b]pyridazin-6-yl)pyrrolidine-3,4-diol (PubChem CID 106673388) has the molecular formula C8H10N6O2 and a molecular weight of 222.21 g/mol. Its IUPAC name is 1-(tetrazolo[1,5-b]pyridazin-6-yl)pyrrolidine-3,4-diol.
| Compound Name | 1-(tetrazolo[1,5-b]pyridazin-6-yl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106673388 |
| Molecular Formula | C8H10N6O2 |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 1-(tetrazolo[1,5-b]pyridazin-6-yl)pyrrolidine-3,4-diol |
| SMILES | OC1CN(c2ccc3nnnn3n2)CC1O |
| InChI | InChI=1S/C8H10N6O2/c15-5-3-13(4-6(5)16)8-2-1-7-9-11-12-14(7)10-8/h1-2,5-6,15-16H,3-4H2 |
| InChIKey | JWZLCMMXAYEMHP-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 99.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |