C14H15N7 — CID 685555
6-(4-phenylpiperazin-1-yl)tetrazolo[1,5-b]pyridazine (PubChem CID 685555) has the molecular formula C14H15N7 and a molecular weight of 281.32 g/mol. Its IUPAC name is 6-(4-phenylpiperazin-1-yl)tetrazolo[1,5-b]pyridazine.
| Compound Name | 6-(4-phenylpiperazin-1-yl)tetrazolo[1,5-b]pyridazine |
|---|---|
| PubChem CID | 685555 |
| Molecular Formula | C14H15N7 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 6-(4-phenylpiperazin-1-yl)tetrazolo[1,5-b]pyridazine |
| SMILES | c1ccc(N2CCN(c3ccc4nnnn4n3)CC2)cc1 |
| InChI | InChI=1S/C14H15N7/c1-2-4-12(5-3-1)19-8-10-20(11-9-19)14-7-6-13-15-17-18-21(13)16-14/h1-7H,8-11H2 |
| InChIKey | NKXHQCFRKQCOPY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |