C14H28N2O2 — CID 106674036
1-[(2-amino-5-propylcyclohexyl)methyl]pyrrolidine-3,4-diol (PubChem CID 106674036) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-[(2-amino-5-propylcyclohexyl)methyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[(2-amino-5-propylcyclohexyl)methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106674036 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 1-[(2-amino-5-propylcyclohexyl)methyl]pyrrolidine-3,4-diol |
| SMILES | CCCC1CCC(N)C(CN2CC(O)C(O)C2)C1 |
| InChI | InChI=1S/C14H28N2O2/c1-2-3-10-4-5-12(15)11(6-10)7-16-8-13(17)14(18)9-16/h10-14,17-18H,2-9,15H2,1H3 |
| InChIKey | PXMHWYBFRJKRCF-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |