C15H30N2O2 — CID 106674063
1-[(2-amino-5-tert-butylcyclohexyl)methyl]pyrrolidine-3,4-diol (PubChem CID 106674063) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-[(2-amino-5-tert-butylcyclohexyl)methyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[(2-amino-5-tert-butylcyclohexyl)methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106674063 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 1-[(2-amino-5-tert-butylcyclohexyl)methyl]pyrrolidine-3,4-diol |
| SMILES | CC(C)(C)C1CCC(N)C(CN2CC(O)C(O)C2)C1 |
| InChI | InChI=1S/C15H30N2O2/c1-15(2,3)11-4-5-12(16)10(6-11)7-17-8-13(18)14(19)9-17/h10-14,18-19H,4-9,16H2,1-3H3 |
| InChIKey | BHILUMSOGPYYFA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |