About 4-tert-butyl-2-(1,3-dihydroisoindol-2-ylmethyl)cyclohexan-1-amine
4-tert-butyl-2-(1,3-dihydroisoindol-2-ylmethyl)cyclohexan-1-amine (PubChem CID 62611169) has the molecular formula C19H30N2
and a molecular weight of 286.46 g/mol. Its IUPAC name is 4-tert-butyl-2-(1,3-dihydroisoindol-2-ylmethyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-tert-butyl-2-(1,3-dihydroisoindol-2-ylmethyl)cyclohexan-1-amine |
| PubChem CID | 62611169 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 4-tert-butyl-2-(1,3-dihydroisoindol-2-ylmethyl)cyclohexan-1-amine |
| SMILES | CC(C)(C)C1CCC(N)C(CN2Cc3ccccc3C2)C1 |
| InChI | InChI=1S/C19H30N2/c1-19(2,3)17-8-9-18(20)16(10-17)13-21-11-14-6-4-5-7-15(14)12-21/h4-7,16-18H,8-13,20H2,1-3H3 |
| InChIKey | BSGCRKULJXBODD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-2-(1,3-dihydroisoindol-2-ylmethyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2-(1,3-dihydroisoindol-2-ylmethyl)cyclohexan-1-amine?
The IUPAC name of 4-tert-butyl-2-(1,3-dihydroisoindol-2-ylmethyl)cyclohexan-1-amine (CID 62611169) is 4-tert-butyl-2-(1,3-dihydroisoindol-2-ylmethyl)cyclohexan-1-amine.
What is the SMILES notation for 4-tert-butyl-2-(1,3-dihydroisoindol-2-ylmethyl)cyclohexan-1-amine?
The canonical SMILES for 4-tert-butyl-2-(1,3-dihydroisoindol-2-ylmethyl)cyclohexan-1-amine is CC(C)(C)C1CCC(N)C(CN2Cc3ccccc3C2)C1.
What is the InChIKey of 4-tert-butyl-2-(1,3-dihydroisoindol-2-ylmethyl)cyclohexan-1-amine?
The InChIKey is BSGCRKULJXBODD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2/c1-19(2,3)17-8-9-18(20)16(10-17)13-21-11-14-6-4-5-7-15(14)12-21/h4-7,16-18H,8-13,20H2,1-3H3.
What are the key properties of 4-tert-butyl-2-(1,3-dihydroisoindol-2-ylmethyl)cyclohexan-1-amine?
4-tert-butyl-2-(1,3-dihydroisoindol-2-ylmethyl)cyclohexan-1-amine has a molecular weight of 286.46 g/mol, XLogP of 3.79, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2-(1,3-dihydroisoindol-2-ylmethyl)cyclohexan-1-amine is sourced from PubChem (CID 62611169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).