C17H33NO3 — CID 102936492
4-tert-butyl-2-[[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methyl]cyclohexan-1-ol (PubChem CID 102936492) has the molecular formula C17H33NO3 and a molecular weight of 299.45 g/mol. Its IUPAC name is 4-tert-butyl-2-[[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methyl]cyclohexan-1-ol.
| Compound Name | 4-tert-butyl-2-[[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 102936492 |
| Molecular Formula | C17H33NO3 |
| Molecular Weight | 299.45 g/mol |
| Exact Mass | 299.25 |
| IUPAC Name | 4-tert-butyl-2-[[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methyl]cyclohexan-1-ol |
| SMILES | CC1CN(CC2CC(C(C)(C)C)CCC2O)CC(CO)O1 |
| InChI | InChI=1S/C17H33NO3/c1-12-8-18(10-15(11-19)21-12)9-13-7-14(17(2,3)4)5-6-16(13)20/h12-16,19-20H,5-11H2,1-4H3 |
| InChIKey | YUGGXFMWWQXAEQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |