C16H31NO — CID 55094860
4-tert-butyl-2-[(2-methylpyrrolidin-1-yl)methyl]cyclohexan-1-ol (PubChem CID 55094860) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is 4-tert-butyl-2-[(2-methylpyrrolidin-1-yl)methyl]cyclohexan-1-ol.
| Compound Name | 4-tert-butyl-2-[(2-methylpyrrolidin-1-yl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 55094860 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | 4-tert-butyl-2-[(2-methylpyrrolidin-1-yl)methyl]cyclohexan-1-ol |
| SMILES | CC1CCCN1CC1CC(C(C)(C)C)CCC1O |
| InChI | InChI=1S/C16H31NO/c1-12-6-5-9-17(12)11-13-10-14(16(2,3)4)7-8-15(13)18/h12-15,18H,5-11H2,1-4H3 |
| InChIKey | VTQWIBOIVOFSGF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |