About (2R)-1-[[(1R,2R)-2-(4-bromophenyl)cyclopropyl]methyl]-2-methylpyrrolidine
(2R)-1-[[(1R,2R)-2-(4-bromophenyl)cyclopropyl]methyl]-2-methylpyrrolidine (PubChem CID 69230539) has the molecular formula C15H20BrN
and a molecular weight of 294.24 g/mol. Its IUPAC name is (2R)-1-[[(1R,2R)-2-(4-bromophenyl)cyclopropyl]methyl]-2-methylpyrrolidine.
Molecular Properties
| Compound Name | (2R)-1-[[(1R,2R)-2-(4-bromophenyl)cyclopropyl]methyl]-2-methylpyrrolidine |
| PubChem CID | 69230539 |
| Molecular Formula | C15H20BrN |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | (2R)-1-[[(1R,2R)-2-(4-bromophenyl)cyclopropyl]methyl]-2-methylpyrrolidine |
| SMILES | C[C@@H]1CCCN1C[C@@H]1C[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H20BrN/c1-11-3-2-8-17(11)10-13-9-15(13)12-4-6-14(16)7-5-12/h4-7,11,13,15H,2-3,8-10H2,1H3/t11-,13+,15+/m1/s1 |
| InChIKey | NMZRPOCZSZTBNJ-ZLDLUXBVSA-N |
| XLogP | 4.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-1-[[(1R,2R)-2-(4-bromophenyl)cyclopropyl]methyl]-2-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[[(1R,2R)-2-(4-bromophenyl)cyclopropyl]methyl]-2-methylpyrrolidine?
The IUPAC name of (2R)-1-[[(1R,2R)-2-(4-bromophenyl)cyclopropyl]methyl]-2-methylpyrrolidine (CID 69230539) is (2R)-1-[[(1R,2R)-2-(4-bromophenyl)cyclopropyl]methyl]-2-methylpyrrolidine.
What is the SMILES notation for (2R)-1-[[(1R,2R)-2-(4-bromophenyl)cyclopropyl]methyl]-2-methylpyrrolidine?
The canonical SMILES for (2R)-1-[[(1R,2R)-2-(4-bromophenyl)cyclopropyl]methyl]-2-methylpyrrolidine is C[C@@H]1CCCN1C[C@@H]1C[C@H]1c1ccc(Br)cc1.
What is the InChIKey of (2R)-1-[[(1R,2R)-2-(4-bromophenyl)cyclopropyl]methyl]-2-methylpyrrolidine?
The InChIKey is NMZRPOCZSZTBNJ-ZLDLUXBVSA-N. The full InChI is InChI=1S/C15H20BrN/c1-11-3-2-8-17(11)10-13-9-15(13)12-4-6-14(16)7-5-12/h4-7,11,13,15H,2-3,8-10H2,1H3/t11-,13+,15+/m1/s1.
What are the key properties of (2R)-1-[[(1R,2R)-2-(4-bromophenyl)cyclopropyl]methyl]-2-methylpyrrolidine?
(2R)-1-[[(1R,2R)-2-(4-bromophenyl)cyclopropyl]methyl]-2-methylpyrrolidine has a molecular weight of 294.24 g/mol, XLogP of 4.04, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[[(1R,2R)-2-(4-bromophenyl)cyclopropyl]methyl]-2-methylpyrrolidine is sourced from PubChem (CID 69230539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).