C12H23NO3 — CID 102936505
2-[[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methyl]cyclopentan-1-ol (PubChem CID 102936505) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is 2-[[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methyl]cyclopentan-1-ol.
| Compound Name | 2-[[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 102936505 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 2-[[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methyl]cyclopentan-1-ol |
| SMILES | CC1CN(CC2CCCC2O)CC(CO)O1 |
| InChI | InChI=1S/C12H23NO3/c1-9-5-13(7-11(8-14)16-9)6-10-3-2-4-12(10)15/h9-12,14-15H,2-8H2,1H3 |
| InChIKey | QIUFJCZLCJYCHC-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |