C5H11N3O3 — CID 106674265
N',3,4-trihydroxypyrrolidine-1-carboximidamide (PubChem CID 106674265) has the molecular formula C5H11N3O3 and a molecular weight of 161.16 g/mol. Its IUPAC name is N',3,4-trihydroxypyrrolidine-1-carboximidamide.
| Compound Name | N',3,4-trihydroxypyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 106674265 |
| Molecular Formula | C5H11N3O3 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | N',3,4-trihydroxypyrrolidine-1-carboximidamide |
| SMILES | NC(=NO)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C5H11N3O3/c6-5(7-11)8-1-3(9)4(10)2-8/h3-4,9-11H,1-2H2,(H2,6,7) |
| InChIKey | WVDVTDKGKBYRSI-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|