C15H17BrN2O2 — CID 106674883
5-bromo-2-[2-(1-cyclopropylethylamino)ethyl]isoindole-1,3-dione (PubChem CID 106674883) has the molecular formula C15H17BrN2O2 and a molecular weight of 337.22 g/mol. Its IUPAC name is 5-bromo-2-[2-(1-cyclopropylethylamino)ethyl]isoindole-1,3-dione.
| Compound Name | 5-bromo-2-[2-(1-cyclopropylethylamino)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 106674883 |
| Molecular Formula | C15H17BrN2O2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 5-bromo-2-[2-(1-cyclopropylethylamino)ethyl]isoindole-1,3-dione |
| SMILES | CC(NCCN1C(=O)c2ccc(Br)cc2C1=O)C1CC1 |
| InChI | InChI=1S/C15H17BrN2O2/c1-9(10-2-3-10)17-6-7-18-14(19)12-5-4-11(16)8-13(12)15(18)20/h4-5,8-10,17H,2-3,6-7H2,1H3 |
| InChIKey | LWSWTYHRIOWDJT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|