C10H19BrO3S — CID 106676218
3-(1-bromo-3-methoxy-3-methylbutyl)thiolane 1,1-dioxide (PubChem CID 106676218) has the molecular formula C10H19BrO3S and a molecular weight of 299.23 g/mol. Its IUPAC name is 3-(1-bromo-3-methoxy-3-methylbutyl)thiolane 1,1-dioxide.
| Compound Name | 3-(1-bromo-3-methoxy-3-methylbutyl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 106676218 |
| Molecular Formula | C10H19BrO3S |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 3-(1-bromo-3-methoxy-3-methylbutyl)thiolane 1,1-dioxide |
| SMILES | COC(C)(C)CC(Br)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19BrO3S/c1-10(2,14-3)6-9(11)8-4-5-15(12,13)7-8/h8-9H,4-7H2,1-3H3 |
| InChIKey | XTSLLVBQAGCNHR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|