C11H21BrO3S — CID 104650684
3-(1-bromo-6-methoxyhexan-2-yl)thiolane 1,1-dioxide (PubChem CID 104650684) has the molecular formula C11H21BrO3S and a molecular weight of 313.26 g/mol. Its IUPAC name is 3-(1-bromo-6-methoxyhexan-2-yl)thiolane 1,1-dioxide.
| Compound Name | 3-(1-bromo-6-methoxyhexan-2-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 104650684 |
| Molecular Formula | C11H21BrO3S |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 3-(1-bromo-6-methoxyhexan-2-yl)thiolane 1,1-dioxide |
| SMILES | COCCCCC(CBr)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H21BrO3S/c1-15-6-3-2-4-10(8-12)11-5-7-16(13,14)9-11/h10-11H,2-9H2,1H3 |
| InChIKey | ADFAGAGTRRSLJK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|