C10H17BrO3S — CID 66043470
3-[3-(bromomethyl)oxan-3-yl]thiolane 1,1-dioxide (PubChem CID 66043470) has the molecular formula C10H17BrO3S and a molecular weight of 297.21 g/mol. Its IUPAC name is 3-[3-(bromomethyl)oxan-3-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[3-(bromomethyl)oxan-3-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 66043470 |
| Molecular Formula | C10H17BrO3S |
| Molecular Weight | 297.21 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 3-[3-(bromomethyl)oxan-3-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C2(CBr)CCCOC2)C1 |
| InChI | InChI=1S/C10H17BrO3S/c11-7-10(3-1-4-14-8-10)9-2-5-15(12,13)6-9/h9H,1-8H2 |
| InChIKey | IRQFTVKXLOAEGB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|