C12H19Br2F3O3S — CID 79445336
3-[1-bromo-2-(bromomethyl)-5-(2,2,2-trifluoroethoxy)pentan-2-yl]thiolane 1,1-dioxide (PubChem CID 79445336) has the molecular formula C12H19Br2F3O3S and a molecular weight of 460.15 g/mol. Its IUPAC name is 3-[1-bromo-2-(bromomethyl)-5-(2,2,2-trifluoroethoxy)pentan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-bromo-2-(bromomethyl)-5-(2,2,2-trifluoroethoxy)pentan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 79445336 |
| Molecular Formula | C12H19Br2F3O3S |
| Molecular Weight | 460.15 g/mol |
| Exact Mass | 457.94 |
| IUPAC Name | 3-[1-bromo-2-(bromomethyl)-5-(2,2,2-trifluoroethoxy)pentan-2-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C(CBr)(CBr)CCCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C12H19Br2F3O3S/c13-7-11(8-14,10-2-5-21(18,19)6-10)3-1-4-20-9-12(15,16)17/h10H,1-9H2 |
| InChIKey | YTISHAUUHIHRDW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.15 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|