C11H12ClFO2 — CID 106677607
1-(2-chloro-3-fluorophenyl)-5-hydroxypentan-2-one (PubChem CID 106677607) has the molecular formula C11H12ClFO2 and a molecular weight of 230.67 g/mol. Its IUPAC name is 1-(2-chloro-3-fluorophenyl)-5-hydroxypentan-2-one.
| Compound Name | 1-(2-chloro-3-fluorophenyl)-5-hydroxypentan-2-one |
|---|---|
| PubChem CID | 106677607 |
| Molecular Formula | C11H12ClFO2 |
| Molecular Weight | 230.67 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 1-(2-chloro-3-fluorophenyl)-5-hydroxypentan-2-one |
| SMILES | O=C(CCCO)Cc1cccc(F)c1Cl |
| InChI | InChI=1S/C11H12ClFO2/c12-11-8(3-1-5-10(11)13)7-9(15)4-2-6-14/h1,3,5,14H,2,4,6-7H2 |
| InChIKey | NUKXYAZUQNOLLV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.67 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |