C13H16ClFO — CID 112653318
1-(2-chloro-3-fluorophenyl)-4,4-dimethylpentan-2-one (PubChem CID 112653318) has the molecular formula C13H16ClFO and a molecular weight of 242.72 g/mol. Its IUPAC name is 1-(2-chloro-3-fluorophenyl)-4,4-dimethylpentan-2-one.
| Compound Name | 1-(2-chloro-3-fluorophenyl)-4,4-dimethylpentan-2-one |
|---|---|
| PubChem CID | 112653318 |
| Molecular Formula | C13H16ClFO |
| Molecular Weight | 242.72 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 1-(2-chloro-3-fluorophenyl)-4,4-dimethylpentan-2-one |
| SMILES | CC(C)(C)CC(=O)Cc1cccc(F)c1Cl |
| InChI | InChI=1S/C13H16ClFO/c1-13(2,3)8-10(16)7-9-5-4-6-11(15)12(9)14/h4-6H,7-8H2,1-3H3 |
| InChIKey | YOIGOTCAXSXLIP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.72 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |