C10H14N4S — CID 106678195
N-([1,3]thiazolo[4,5-b]pyrazin-2-ylmethyl)butan-2-amine (PubChem CID 106678195) has the molecular formula C10H14N4S and a molecular weight of 222.32 g/mol. Its IUPAC name is N-([1,3]thiazolo[4,5-b]pyrazin-2-ylmethyl)butan-2-amine.
| Compound Name | N-([1,3]thiazolo[4,5-b]pyrazin-2-ylmethyl)butan-2-amine |
|---|---|
| PubChem CID | 106678195 |
| Molecular Formula | C10H14N4S |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | N-([1,3]thiazolo[4,5-b]pyrazin-2-ylmethyl)butan-2-amine |
| SMILES | CCC(C)NCc1nc2nccnc2s1 |
| InChI | InChI=1S/C10H14N4S/c1-3-7(2)13-6-8-14-9-10(15-8)12-5-4-11-9/h4-5,7,13H,3,6H2,1-2H3 |
| InChIKey | JFNOALMGIAWCMY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |