C15H18N4OS — CID 106678707
4-(3-aminopyrazin-2-yl)sulfanyl-N-(3-methylphenyl)butanamide (PubChem CID 106678707) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 4-(3-aminopyrazin-2-yl)sulfanyl-N-(3-methylphenyl)butanamide.
| Compound Name | 4-(3-aminopyrazin-2-yl)sulfanyl-N-(3-methylphenyl)butanamide |
|---|---|
| PubChem CID | 106678707 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 4-(3-aminopyrazin-2-yl)sulfanyl-N-(3-methylphenyl)butanamide |
| SMILES | Cc1cccc(NC(=O)CCCSc2nccnc2N)c1 |
| InChI | InChI=1S/C15H18N4OS/c1-11-4-2-5-12(10-11)19-13(20)6-3-9-21-15-14(16)17-7-8-18-15/h2,4-5,7-8,10H,3,6,9H2,1H3,(H2,16,17)(H,19,20) |
| InChIKey | ZNHLTSPPNUACEX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|