C15H22O3 — CID 106679767
1-(2-methoxy-4,6-dimethylphenyl)-1-(oxolan-3-yl)ethanol (PubChem CID 106679767) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-(2-methoxy-4,6-dimethylphenyl)-1-(oxolan-3-yl)ethanol.
| Compound Name | 1-(2-methoxy-4,6-dimethylphenyl)-1-(oxolan-3-yl)ethanol |
|---|---|
| PubChem CID | 106679767 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 1-(2-methoxy-4,6-dimethylphenyl)-1-(oxolan-3-yl)ethanol |
| SMILES | COc1cc(C)cc(C)c1C(C)(O)C1CCOC1 |
| InChI | InChI=1S/C15H22O3/c1-10-7-11(2)14(13(8-10)17-4)15(3,16)12-5-6-18-9-12/h7-8,12,16H,5-6,9H2,1-4H3 |
| InChIKey | YXKSYEDQPHBYPF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |