C22H16N2O5 — CID 10667990
6-benzyl-7-methyl-3-(4-nitrophenyl)pyrano[3,2-c]pyridine-2,5-dione (PubChem CID 10667990) has the molecular formula C22H16N2O5 and a molecular weight of 388.38 g/mol. Its IUPAC name is 6-benzyl-7-methyl-3-(4-nitrophenyl)pyrano[3,2-c]pyridine-2,5-dione.
| Compound Name | 6-benzyl-7-methyl-3-(4-nitrophenyl)pyrano[3,2-c]pyridine-2,5-dione |
|---|---|
| PubChem CID | 10667990 |
| Molecular Formula | C22H16N2O5 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 6-benzyl-7-methyl-3-(4-nitrophenyl)pyrano[3,2-c]pyridine-2,5-dione |
| SMILES | Cc1cc2oc(=O)c(-c3ccc([N+](=O)[O-])cc3)cc2c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C22H16N2O5/c1-14-11-20-19(21(25)23(14)13-15-5-3-2-4-6-15)12-18(22(26)29-20)16-7-9-17(10-8-16)24(27)28/h2-12H,13H2,1H3 |
| InChIKey | MGXBZDINZBEUQS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 95.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|