C14H17NS2 — CID 10668
View drug profile → dimethylthiambuteneN,N-dimethyl-4,4-dithiophen-2-ylbut-3-en-2-amine (PubChem CID 10668) has the molecular formula C14H17NS2 and a molecular weight of 263.43 g/mol. Its IUPAC name is N,N-dimethyl-4,4-dithiophen-2-ylbut-3-en-2-amine.
| Compound Name | N,N-dimethyl-4,4-dithiophen-2-ylbut-3-en-2-amine |
|---|---|
| PubChem CID | 10668 |
| Molecular Formula | C14H17NS2 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | N,N-dimethyl-4,4-dithiophen-2-ylbut-3-en-2-amine |
| SMILES | CC(C=C(c1cccs1)c1cccs1)N(C)C |
| InChI | InChI=1S/C14H17NS2/c1-11(15(2)3)10-12(13-6-4-8-16-13)14-7-5-9-17-14/h4-11H,1-3H3 |
| InChIKey | CANBGVXYBPOLRR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |