C16H21NS2 — CID 6833
N,N-diethyl-4,4-dithiophen-2-ylbut-3-en-2-amine (PubChem CID 6833) has the molecular formula C16H21NS2 and a molecular weight of 291.49 g/mol. Its IUPAC name is N,N-diethyl-4,4-dithiophen-2-ylbut-3-en-2-amine.
| Compound Name | N,N-diethyl-4,4-dithiophen-2-ylbut-3-en-2-amine |
|---|---|
| PubChem CID | 6833 |
| Molecular Formula | C16H21NS2 |
| Molecular Weight | 291.49 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N,N-diethyl-4,4-dithiophen-2-ylbut-3-en-2-amine |
| SMILES | CCN(CC)C(C)C=C(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C16H21NS2/c1-4-17(5-2)13(3)12-14(15-8-6-10-18-15)16-9-7-11-19-16/h6-13H,4-5H2,1-3H3 |
| InChIKey | CBYWMRHUUVRIAF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |