C17H28O2 — CID 106682520
2-ethyl-1-(2-methoxy-4,6-dimethylphenyl)hexan-1-ol (PubChem CID 106682520) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-ethyl-1-(2-methoxy-4,6-dimethylphenyl)hexan-1-ol.
| Compound Name | 2-ethyl-1-(2-methoxy-4,6-dimethylphenyl)hexan-1-ol |
|---|---|
| PubChem CID | 106682520 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 2-ethyl-1-(2-methoxy-4,6-dimethylphenyl)hexan-1-ol |
| SMILES | CCCCC(CC)C(O)c1c(C)cc(C)cc1OC |
| InChI | InChI=1S/C17H28O2/c1-6-8-9-14(7-2)17(18)16-13(4)10-12(3)11-15(16)19-5/h10-11,14,17-18H,6-9H2,1-5H3 |
| InChIKey | ZMRMTIGQRIHIPT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |