C15H24O2 — CID 106682562
1-(2-methoxy-4,6-dimethylphenyl)-2,3-dimethylbutan-1-ol (PubChem CID 106682562) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 1-(2-methoxy-4,6-dimethylphenyl)-2,3-dimethylbutan-1-ol.
| Compound Name | 1-(2-methoxy-4,6-dimethylphenyl)-2,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 106682562 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 1-(2-methoxy-4,6-dimethylphenyl)-2,3-dimethylbutan-1-ol |
| SMILES | COc1cc(C)cc(C)c1C(O)C(C)C(C)C |
| InChI | InChI=1S/C15H24O2/c1-9(2)12(5)15(16)14-11(4)7-10(3)8-13(14)17-6/h7-9,12,15-16H,1-6H3 |
| InChIKey | VQXVUWLNGFNFKP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |