C11H15ClO3S — CID 116866342
1-(2-methoxy-4,6-dimethylphenyl)ethanesulfonyl chloride (PubChem CID 116866342) has the molecular formula C11H15ClO3S and a molecular weight of 262.76 g/mol. Its IUPAC name is 1-(2-methoxy-4,6-dimethylphenyl)ethanesulfonyl chloride.
| Compound Name | 1-(2-methoxy-4,6-dimethylphenyl)ethanesulfonyl chloride |
|---|---|
| PubChem CID | 116866342 |
| Molecular Formula | C11H15ClO3S |
| Molecular Weight | 262.76 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 1-(2-methoxy-4,6-dimethylphenyl)ethanesulfonyl chloride |
| SMILES | COc1cc(C)cc(C)c1C(C)S(=O)(=O)Cl |
| InChI | InChI=1S/C11H15ClO3S/c1-7-5-8(2)11(10(6-7)15-4)9(3)16(12,13)14/h5-6,9H,1-4H3 |
| InChIKey | XZPITWVOZUHUJS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.76 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |